C28H32IN7O3 — CID 3099495
[4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-iodobenzoate (PubChem CID 3099495) has the molecular formula C28H32IN7O3 and a molecular weight of 641.51 g/mol. Its IUPAC name is [4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-iodobenzoate.
| Compound Name | [4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 3099495 |
| Molecular Formula | C28H32IN7O3 |
| Molecular Weight | 641.51 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | [4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-iodobenzoate |
| SMILES | COc1cc(C=NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1OC(=O)c1ccccc1I |
| InChI | InChI=1S/C28H32IN7O3/c1-38-24-18-20(12-13-23(24)39-25(37)21-10-4-5-11-22(21)29)19-30-34-26-31-27(35-14-6-2-7-15-35)33-28(32-26)36-16-8-3-9-17-36/h4-5,10-13,18-19H,2-3,6-9,14-17H2,1H3,(H,31,32,33,34) |
| InChIKey | MZIKOEZYYLYTIR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|