C26H28BrN7O5 — CID 6018653
[4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate (PubChem CID 6018653) has the molecular formula C26H28BrN7O5 and a molecular weight of 598.46 g/mol. Its IUPAC name is [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate.
| Compound Name | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 6018653 |
| Molecular Formula | C26H28BrN7O5 |
| Molecular Weight | 598.46 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate |
| SMILES | COc1cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C26H28BrN7O5/c1-36-22-16-18(6-7-21(22)39-23(35)19-4-2-3-5-20(19)27)17-28-32-24-29-25(33-8-12-37-13-9-33)31-26(30-24)34-10-14-38-15-11-34/h2-7,16-17H,8-15H2,1H3,(H,29,30,31,32)/b28-17- |
| InChIKey | ZZRVGAXXZZJTQN-QRQIAZFYSA-N |
| XLogP | 2.98 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|