C26H30N8O6 — CID 124542905
N-[(Z)-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 124542905) has the molecular formula C26H30N8O6 and a molecular weight of 550.58 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(Z)-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 124542905 |
| Molecular Formula | C26H30N8O6 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N8O6/c1-37-23-16-19(6-7-22(23)40-18-20-4-2-3-5-21(20)34(35)36)17-27-31-24-28-25(32-8-12-38-13-9-32)30-26(29-24)33-10-14-39-15-11-33/h2-7,16-17H,8-15,18H2,1H3,(H,28,29,30,31)/b27-17- |
| InChIKey | QMNSFATYKJZPIQ-PKAZHMFMSA-N |
| XLogP | 2.49 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|