C27H26N8O4 — CID 6260475
6-morpholin-4-yl-2-N-[(Z)-[4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 6260475) has the molecular formula C27H26N8O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is 6-morpholin-4-yl-2-N-[(Z)-[4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-2-N-[(Z)-[4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6260475 |
| Molecular Formula | C27H26N8O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 6-morpholin-4-yl-2-N-[(Z)-[4-[(2-nitrophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccccc1COc1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C27H26N8O4/c36-35(37)24-9-5-4-6-21(24)19-39-23-12-10-20(11-13-23)18-28-33-26-30-25(29-22-7-2-1-3-8-22)31-27(32-26)34-14-16-38-17-15-34/h1-13,18H,14-17,19H2,(H2,29,30,31,32,33)/b28-18- |
| InChIKey | CLFYZKVCWMKXMV-VEILYXNESA-N |
| XLogP | 4.39 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|