C31H27Br2N7O2 — CID 50870674
2-N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 50870674) has the molecular formula C31H27Br2N7O2 and a molecular weight of 689.41 g/mol. Its IUPAC name is 2-N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 50870674 |
| Molecular Formula | C31H27Br2N7O2 |
| Molecular Weight | 689.41 g/mol |
| Exact Mass | 687.06 |
| IUPAC Name | 2-N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Brc1cc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H27Br2N7O2/c32-26-17-21(18-27(33)28(26)42-20-23-9-6-8-22-7-4-5-12-25(22)23)19-34-39-30-36-29(35-24-10-2-1-3-11-24)37-31(38-30)40-13-15-41-16-14-40/h1-12,17-19H,13-16,20H2,(H2,35,36,37,38,39)/b34-19+ |
| InChIKey | XUQYKIIRPZZBOJ-ALQBTCKLSA-N |
| XLogP | 7.16 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.41 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|