C22H24BrN7O4 — CID 135419567
2-bromo-6-methoxy-4-[(E)-[[4-(4-methoxyanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 135419567) has the molecular formula C22H24BrN7O4 and a molecular weight of 530.38 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(E)-[[4-(4-methoxyanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(E)-[[4-(4-methoxyanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135419567 |
| Molecular Formula | C22H24BrN7O4 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(E)-[[4-(4-methoxyanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | COc1ccc(Nc2nc(N/N=C/c3cc(Br)c(O)c(OC)c3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H24BrN7O4/c1-32-16-5-3-15(4-6-16)25-20-26-21(28-22(27-20)30-7-9-34-10-8-30)29-24-13-14-11-17(23)19(31)18(12-14)33-2/h3-6,11-13,31H,7-10H2,1-2H3,(H2,25,26,27,28,29)/b24-13+ |
| InChIKey | UJQCJABPPZMZRN-ZMOGYAJESA-N |
| XLogP | 3.38 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|