C21H23N7O3 — CID 135593794
4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135593794) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135593794 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)ccc1O |
| InChI | InChI=1S/C21H23N7O3/c1-30-18-13-15(7-8-17(18)29)14-22-27-20-24-19(23-16-5-3-2-4-6-16)25-21(26-20)28-9-11-31-12-10-28/h2-8,13-14,29H,9-12H2,1H3,(H2,23,24,25,26,27)/b22-14+ |
| InChIKey | NPKJMGDALDGZNE-HYARGMPZSA-N |
| XLogP | 2.61 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|