C23H24BrN7O5 — CID 6028929
2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetic acid (PubChem CID 6028929) has the molecular formula C23H24BrN7O5 and a molecular weight of 558.39 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 6028929 |
| Molecular Formula | C23H24BrN7O5 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 2-[4-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N\Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C23H24BrN7O5/c1-34-18-12-15(11-17(24)20(18)36-14-19(32)33)13-25-30-22-27-21(26-16-5-3-2-4-6-16)28-23(29-22)31-7-9-35-10-8-31/h2-6,11-13H,7-10,14H2,1H3,(H,32,33)(H2,26,27,28,29,30)/b25-13- |
| InChIKey | JNJABCLOYAGBOY-MXAYSNPKSA-N |
| XLogP | 3.13 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|