C23H25N7O3 — CID 6024761
2-[3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6024761) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6024761 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(/C=N\Nc2nc(Nc3ccccc3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C23H25N7O3/c31-20(32)16-33-19-11-7-8-17(14-19)15-24-29-22-26-21(25-18-9-3-1-4-10-18)27-23(28-22)30-12-5-2-6-13-30/h1,3-4,7-11,14-15H,2,5-6,12-13,16H2,(H,31,32)(H2,25,26,27,28,29)/b24-15- |
| InChIKey | DHHBQBNKDFUENU-IWIPYMOSSA-N |
| XLogP | 3.51 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|