C28H27N7O2 — CID 5340992
[4-[(E)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 5340992) has the molecular formula C28H27N7O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is [4-[(E)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(E)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5340992 |
| Molecular Formula | C28H27N7O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | [4-[(E)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCCCC3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H27N7O2/c36-25(22-10-4-1-5-11-22)37-24-16-14-21(15-17-24)20-29-34-27-31-26(30-23-12-6-2-7-13-23)32-28(33-27)35-18-8-3-9-19-35/h1-2,4-7,10-17,20H,3,8-9,18-19H2,(H2,30,31,32,33,34)/b29-20+ |
| InChIKey | VKMVCXRQIKBCKZ-ZTKZIYFRSA-N |
| XLogP | 5.27 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|