C27H32N8O — CID 155545896
N-[(E)-benzylideneamino]-4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 155545896) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[(E)-benzylideneamino]-4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 155545896 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | O=C(N/N=C/c1ccccc1)c1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C27H32N8O/c36-24(33-28-20-21-10-4-1-5-11-21)22-12-14-23(15-13-22)29-25-30-26(34-16-6-2-7-17-34)32-27(31-25)35-18-8-3-9-19-35/h1,4-5,10-15,20H,2-3,6-9,16-19H2,(H,33,36)(H,29,30,31,32)/b28-20+ |
| InChIKey | YKVIBWUHKJCFMC-VFCFBJKWSA-N |
| XLogP | 4.36 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|