C20H22N8O — CID 46854707
N'-(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)pyridine-4-carbohydrazide (PubChem CID 46854707) has the molecular formula C20H22N8O and a molecular weight of 390.45 g/mol. Its IUPAC name is N'-(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)pyridine-4-carbohydrazide.
| Compound Name | N'-(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 46854707 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N'-(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNc1nc(Nc2ccccc2)nc(N2CCCCC2)n1)c1ccncc1 |
| InChI | InChI=1S/C20H22N8O/c29-17(15-9-11-21-12-10-15)26-27-19-23-18(22-16-7-3-1-4-8-16)24-20(25-19)28-13-5-2-6-14-28/h1,3-4,7-12H,2,5-6,13-14H2,(H,26,29)(H2,22,23,24,25,27) |
| InChIKey | UILIHQIAPPXBKQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|