C21H19N9O — CID 71591650
N'-[4-(3-methylanilino)-6-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]pyridine-4-carbohydrazide (PubChem CID 71591650) has the molecular formula C21H19N9O and a molecular weight of 413.45 g/mol. Its IUPAC name is N'-[4-(3-methylanilino)-6-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[4-(3-methylanilino)-6-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 71591650 |
| Molecular Formula | C21H19N9O |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N'-[4-(3-methylanilino)-6-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]pyridine-4-carbohydrazide |
| SMILES | Cc1cccc(Nc2nc(NNC(=O)c3ccncc3)nc(Nc3ccccn3)n2)c1 |
| InChI | InChI=1S/C21H19N9O/c1-14-5-4-6-16(13-14)24-19-26-20(25-17-7-2-3-10-23-17)28-21(27-19)30-29-18(31)15-8-11-22-12-9-15/h2-13H,1H3,(H,29,31)(H3,23,24,25,26,27,28,30) |
| InChIKey | NPRZXSCXWSKADW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|