C19H16BrN3O — CID 109176276
N-(3-bromophenyl)-2-(3-methylanilino)pyridine-4-carboxamide (PubChem CID 109176276) has the molecular formula C19H16BrN3O and a molecular weight of 382.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(3-methylanilino)pyridine-4-carboxamide.
| Compound Name | N-(3-bromophenyl)-2-(3-methylanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109176276 |
| Molecular Formula | C19H16BrN3O |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-(3-bromophenyl)-2-(3-methylanilino)pyridine-4-carboxamide |
| SMILES | Cc1cccc(Nc2cc(C(=O)Nc3cccc(Br)c3)ccn2)c1 |
| InChI | InChI=1S/C19H16BrN3O/c1-13-4-2-6-16(10-13)22-18-11-14(8-9-21-18)19(24)23-17-7-3-5-15(20)12-17/h2-12H,1H3,(H,21,22)(H,23,24) |
| InChIKey | UZDANWWFFUFKDH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |