C20H18ClN3O2 — CID 109176255
N-(3-chloro-4-methoxyphenyl)-2-(3-methylanilino)pyridine-4-carboxamide (PubChem CID 109176255) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(3-methylanilino)pyridine-4-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(3-methylanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109176255 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(3-methylanilino)pyridine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(Nc3cccc(C)c3)c2)cc1Cl |
| InChI | InChI=1S/C20H18ClN3O2/c1-13-4-3-5-15(10-13)23-19-11-14(8-9-22-19)20(25)24-16-6-7-18(26-2)17(21)12-16/h3-12H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | TZHMYRNTHZPBMB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |