C19H20N6O2 — CID 14064847
2-[[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl]amino]acetic acid (PubChem CID 14064847) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl]amino]acetic acid.
| Compound Name | 2-[[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 14064847 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl]amino]acetic acid |
| SMILES | Cc1cccc(Nc2nc(NCC(=O)O)nc(Nc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C19H20N6O2/c1-12-5-3-7-14(9-12)21-18-23-17(20-11-16(26)27)24-19(25-18)22-15-8-4-6-13(2)10-15/h3-10H,11H2,1-2H3,(H,26,27)(H3,20,21,22,23,24,25) |
| InChIKey | CSXYJEWFOBNIDX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |