C16H14ClN5O3S — CID 59346269
4-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 59346269) has the molecular formula C16H14ClN5O3S and a molecular weight of 391.84 g/mol. Its IUPAC name is 4-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59346269 |
| Molecular Formula | C16H14ClN5O3S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 4-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Cc1cccc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)O)cc3)n2)c1 |
| InChI | InChI=1S/C16H14ClN5O3S/c1-10-3-2-4-12(9-10)19-16-21-14(17)20-15(22-16)18-11-5-7-13(8-6-11)26(23,24)25/h2-9H,1H3,(H,23,24,25)(H2,18,19,20,21,22) |
| InChIKey | NIXQVPIYJIUHNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|