C15H12N5NaO7S2 — CID 101326523
sodium 4,6-bis(4-sulfoanilino)-1,3,5-triazin-2-olate (PubChem CID 101326523) has the molecular formula C15H12N5NaO7S2 and a molecular weight of 461.41 g/mol. Its IUPAC name is sodium 4,6-bis(4-sulfoanilino)-1,3,5-triazin-2-olate.
| Compound Name | sodium 4,6-bis(4-sulfoanilino)-1,3,5-triazin-2-olate |
|---|---|
| PubChem CID | 101326523 |
| Molecular Formula | C15H12N5NaO7S2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | sodium 4,6-bis(4-sulfoanilino)-1,3,5-triazin-2-olate |
| SMILES | O=S(=O)(O)c1ccc(Nc2nc([O-])nc(Nc3ccc(S(=O)(=O)O)cc3)n2)cc1.[Na+] |
| InChI | InChI=1S/C15H13N5O7S2.Na/c21-15-19-13(16-9-1-5-11(6-2-9)28(22,23)24)18-14(20-15)17-10-3-7-12(8-4-10)29(25,26)27;/h1-8H,(H,22,23,24)(H,25,26,27)(H3,16,17,18,19,20,21);/q;+1/p-1 |
| InChIKey | DMXJWAGRSBMQBJ-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 194.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|