C12H16N6O6S2 — CID 88584275
4-[[4-(aminomethyl)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 88584275) has the molecular formula C12H16N6O6S2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-(aminomethyl)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 88584275 |
| Molecular Formula | C12H16N6O6S2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-[[4-(aminomethyl)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | NCc1nc(NCCS(=O)(=O)O)nc(Nc2ccc(S(=O)(=O)O)cc2)n1 |
| InChI | InChI=1S/C12H16N6O6S2/c13-7-10-16-11(14-5-6-25(19,20)21)18-12(17-10)15-8-1-3-9(4-2-8)26(22,23)24/h1-4H,5-7,13H2,(H,19,20,21)(H,22,23,24)(H2,14,15,16,17,18) |
| InChIKey | JAVZWGXWPZNQBH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 197.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|