C24H29N7O6S2 — CID 143554824
6-[[4-(2-aminoethylamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-8-methylnaphthalene-2-sulfonic acid;ethane (PubChem CID 143554824) has the molecular formula C24H29N7O6S2 and a molecular weight of 575.67 g/mol. Its IUPAC name is 6-[[4-(2-aminoethylamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-8-methylnaphthalene-2-sulfonic acid;ethane.
| Compound Name | 6-[[4-(2-aminoethylamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-8-methylnaphthalene-2-sulfonic acid;ethane |
|---|---|
| PubChem CID | 143554824 |
| Molecular Formula | C24H29N7O6S2 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 6-[[4-(2-aminoethylamino)-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-8-methylnaphthalene-2-sulfonic acid;ethane |
| SMILES | CC.Cc1cc(Nc2nc(NCCN)nc(Nc3ccc(S(=O)(=O)O)cc3)n2)cc2ccc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C22H23N7O6S2.C2H6/c1-13-10-16(11-14-2-5-18(12-19(13)14)37(33,34)35)26-22-28-20(24-9-8-23)27-21(29-22)25-15-3-6-17(7-4-15)36(30,31)32;1-2/h2-7,10-12H,8-9,23H2,1H3,(H,30,31,32)(H,33,34,35)(H3,24,25,26,27,28,29);1-2H3 |
| InChIKey | WQOGHBBEJWKYSL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 209.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|