C16H15ClN6O6S2 — CID 89226276
2-amino-4-[[4-chloro-6-(2-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 89226276) has the molecular formula C16H15ClN6O6S2 and a molecular weight of 486.92 g/mol. Its IUPAC name is 2-amino-4-[[4-chloro-6-(2-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-chloro-6-(2-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 89226276 |
| Molecular Formula | C16H15ClN6O6S2 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-amino-4-[[4-chloro-6-(2-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1Nc1nc(Cl)nc(Nc2ccc(S(=O)(=O)O)c(N)c2)n1 |
| InChI | InChI=1S/C16H15ClN6O6S2/c1-8-6-10(30(24,25)26)3-4-12(8)20-16-22-14(17)21-15(23-16)19-9-2-5-13(11(18)7-9)31(27,28)29/h2-7H,18H2,1H3,(H,24,25,26)(H,27,28,29)(H2,19,20,21,22,23) |
| InChIKey | XGEFJBKFQQOZND-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 197.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|