C9H8ClN6NaO3S — CID 23684092
sodium 2-amino-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]benzenesulfonate (PubChem CID 23684092) has the molecular formula C9H8ClN6NaO3S and a molecular weight of 338.71 g/mol. Its IUPAC name is sodium 2-amino-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]benzenesulfonate.
| Compound Name | sodium 2-amino-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 23684092 |
| Molecular Formula | C9H8ClN6NaO3S |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | sodium 2-amino-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
| SMILES | Nc1nc(Cl)nc(Nc2ccc(S(=O)(=O)[O-])c(N)c2)n1.[Na+] |
| InChI | InChI=1S/C9H9ClN6O3S.Na/c10-7-14-8(12)16-9(15-7)13-4-1-2-6(5(11)3-4)20(17,18)19;/h1-3H,11H2,(H,17,18,19)(H3,12,13,14,15,16);/q;+1/p-1 |
| InChIKey | QEIJXPHVNOHVHX-UHFFFAOYSA-M |
| XLogP | -2.66 |
| TPSA | 159.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|