C24H20Cl2N8Na2O6S2 — CID 100935828
disodium;5-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 100935828) has the molecular formula C24H20Cl2N8Na2O6S2 and a molecular weight of 697.49 g/mol. Its IUPAC name is disodium;5-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | disodium;5-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 100935828 |
| Molecular Formula | C24H20Cl2N8Na2O6S2 |
| Molecular Weight | 697.49 g/mol |
| Exact Mass | 696.01 |
| IUPAC Name | disodium;5-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-chloro-6-ethyl-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | CCc1nc(Cl)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(Cl)nc(CC)n4)cc3S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2)n1.[Na+].[Na+] |
| InChI | InChI=1S/C24H22Cl2N8O6S2.2Na/c1-3-19-29-21(25)33-23(31-19)27-15-9-7-13(17(11-15)41(35,36)37)5-6-14-8-10-16(12-18(14)42(38,39)40)28-24-32-20(4-2)30-22(26)34-24;;/h5-12H,3-4H2,1-2H3,(H,35,36,37)(H,38,39,40)(H,27,29,31,33)(H,28,30,32,34);;/q;2*+1/p-2/b6-5+;; |
| InChIKey | NKUZONHFEMLELQ-TXOOBNKBSA-L |
| XLogP | -2.04 |
| TPSA | 215.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.49 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|