C20H13Cl4N8NaO6S2+2 — CID 87355454
sodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid;hydron (PubChem CID 87355454) has the molecular formula C20H13Cl4N8NaO6S2+2 and a molecular weight of 690.31 g/mol. Its IUPAC name is sodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid;hydron.
| Compound Name | sodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid;hydron |
|---|---|
| PubChem CID | 87355454 |
| Molecular Formula | C20H13Cl4N8NaO6S2+2 |
| Molecular Weight | 690.31 g/mol |
| Exact Mass | 687.90 |
| IUPAC Name | sodium;5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid;hydron |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Cl)nc(Cl)n2)ccc1/C=C/c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1S(=O)(=O)O.[H+].[Na+] |
| InChI | InChI=1S/C20H12Cl4N8O6S2.Na/c21-15-27-16(22)30-19(29-15)25-11-5-3-9(13(7-11)39(33,34)35)1-2-10-4-6-12(8-14(10)40(36,37)38)26-20-31-17(23)28-18(24)32-20;/h1-8H,(H,33,34,35)(H,36,37,38)(H,25,27,29,30)(H,26,28,31,32);/q;+1/p+1/b2-1+; |
| InChIKey | DDRXTKHUGVOHKS-TYYBGVCCSA-O |
| XLogP | 1.94 |
| TPSA | 210.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|