C24H24Cl2KN10O12S4 — CID 173062816
CID 173062816 (PubChem CID 173062816) has the molecular formula C24H24Cl2KN10O12S4 and a molecular weight of 882.79 g/mol.
| Compound Name | CID 173062816 |
|---|---|
| PubChem CID | 173062816 |
| Molecular Formula | C24H24Cl2KN10O12S4 |
| Molecular Weight | 882.79 g/mol |
| Exact Mass | 880.95 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)CCNc1nc(Cl)nc(Nc2ccc(C=Cc3ccc(Nc4nc(Cl)nc(NCCS(=O)(=O)O)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)n1.[K] |
| InChI | InChI=1S/C24H24Cl2N10O12S4.K/c25-19-31-21(27-7-9-49(37,38)39)35-23(33-19)29-15-5-3-13(17(11-15)51(43,44)45)1-2-14-4-6-16(12-18(14)52(46,47)48)30-24-34-20(26)32-22(36-24)28-8-10-50(40,41)42;/h1-6,11-12H,7-10H2,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H2,27,29,31,33,35)(H2,28,30,32,34,36); |
| InChIKey | LBRNIBIHJFYQJK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 342.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|