C20H30N12O12S4 — CID 21351836
2-[[4-[4-[[4,6-bis(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid (PubChem CID 21351836) has the molecular formula C20H30N12O12S4 and a molecular weight of 758.80 g/mol. Its IUPAC name is 2-[[4-[4-[[4,6-bis(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[4-[[4,6-bis(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 21351836 |
| Molecular Formula | C20H30N12O12S4 |
| Molecular Weight | 758.80 g/mol |
| Exact Mass | 758.10 |
| IUPAC Name | 2-[[4-[4-[[4,6-bis(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCNc1nc(NCCS(=O)(=O)O)nc(Nc2ccc(Nc3nc(NCCS(=O)(=O)O)nc(NCCS(=O)(=O)O)n3)cc2)n1 |
| InChI | InChI=1S/C20H30N12O12S4/c33-45(34,35)9-5-21-15-27-16(22-6-10-46(36,37)38)30-19(29-15)25-13-1-2-14(4-3-13)26-20-31-17(23-7-11-47(39,40)41)28-18(32-20)24-8-12-48(42,43)44/h1-4H,5-12H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44)(H3,21,22,25,27,29,30)(H3,23,24,26,28,31,32) |
| InChIKey | LNOGEHYUAYVKOT-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 367.00 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.80 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|