C9H19N7O6S2 — CID 59787566
2-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid (PubChem CID 59787566) has the molecular formula C9H19N7O6S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 59787566 |
| Molecular Formula | C9H19N7O6S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[[4-(2-aminoethylamino)-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
| SMILES | NCCNc1nc(NCCS(=O)(=O)O)nc(NCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C9H19N7O6S2/c10-1-2-11-7-14-8(12-3-5-23(17,18)19)16-9(15-7)13-4-6-24(20,21)22/h1-6,10H2,(H,17,18,19)(H,20,21,22)(H3,11,12,13,14,15,16) |
| InChIKey | MGTDDCXDUOOENC-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 209.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|