C11H22N6O5S — CID 167346558
2-[[4-[bis(2-hydroxyethyl)amino]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid (PubChem CID 167346558) has the molecular formula C11H22N6O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[[4-[bis(2-hydroxyethyl)amino]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[bis(2-hydroxyethyl)amino]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 167346558 |
| Molecular Formula | C11H22N6O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[[4-[bis(2-hydroxyethyl)amino]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
| SMILES | CCNc1nc(NCCS(=O)(=O)O)nc(N(CCO)CCO)n1 |
| InChI | InChI=1S/C11H22N6O5S/c1-2-12-9-14-10(13-3-8-23(20,21)22)16-11(15-9)17(4-6-18)5-7-19/h18-19H,2-8H2,1H3,(H,20,21,22)(H2,12,13,14,15,16) |
| InChIKey | MXAJAQQZFYHWCS-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|