C20H29N11O5S — CID 59172520
amino 2-[[4-[bis(2-hydroxyethyl)amino]-6-[3-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate (PubChem CID 59172520) has the molecular formula C20H29N11O5S and a molecular weight of 535.59 g/mol. Its IUPAC name is amino 2-[[4-[bis(2-hydroxyethyl)amino]-6-[3-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate.
| Compound Name | amino 2-[[4-[bis(2-hydroxyethyl)amino]-6-[3-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 59172520 |
| Molecular Formula | C20H29N11O5S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | amino 2-[[4-[bis(2-hydroxyethyl)amino]-6-[3-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
| SMILES | Cc1nc(C)nc(Nc2cccc(Nc3nc(NCCS(=O)(=O)ON)nc(N(CCO)CCO)n3)c2)n1 |
| InChI | InChI=1S/C20H29N11O5S/c1-13-23-14(2)25-18(24-13)26-15-4-3-5-16(12-15)27-19-28-17(22-6-11-37(34,35)36-21)29-20(30-19)31(7-9-32)8-10-33/h3-5,12,32-33H,6-11,21H2,1-2H3,(H,23,24,25,26)(H2,22,27,28,29,30) |
| InChIKey | RXTLVJPDJMHVGM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 226.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|