C23H34N11NaO7S — CID 59172487
sodium 2-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[3-[[4-[2-(methoxymethylamino)ethoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate (PubChem CID 59172487) has the molecular formula C23H34N11NaO7S and a molecular weight of 631.65 g/mol. Its IUPAC name is sodium 2-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[3-[[4-[2-(methoxymethylamino)ethoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate.
| Compound Name | sodium 2-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[3-[[4-[2-(methoxymethylamino)ethoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 59172487 |
| Molecular Formula | C23H34N11NaO7S |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | sodium 2-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[3-[[4-[2-(methoxymethylamino)ethoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
| SMILES | COCNCCOc1nc(C)nc(Nc2cccc(Nc3nc(NCCOCCO)nc(NCCS(=O)(=O)[O-])n3)c2)n1.[Na+] |
| InChI | InChI=1S/C23H35N11O7S.Na/c1-16-27-21(34-23(28-16)41-11-6-24-15-39-2)29-17-4-3-5-18(14-17)30-22-32-19(25-7-10-40-12-9-35)31-20(33-22)26-8-13-42(36,37)38;/h3-5,14,24,35H,6-13,15H2,1-2H3,(H,36,37,38)(H,27,28,29,34)(H3,25,26,30,31,32,33);/q;+1/p-1 |
| InChIKey | UKBAEUQEAYJUNQ-UHFFFAOYSA-M |
| XLogP | -3.19 |
| TPSA | 242.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|