C19H24N6O8S2 — CID 90429818
4-[[4-(ethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-1,3,5-triazin-2-yl]amino]naphthalene-2,7-disulfonic acid (PubChem CID 90429818) has the molecular formula C19H24N6O8S2 and a molecular weight of 528.57 g/mol. Its IUPAC name is 4-[[4-(ethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-1,3,5-triazin-2-yl]amino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[4-(ethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-1,3,5-triazin-2-yl]amino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 90429818 |
| Molecular Formula | C19H24N6O8S2 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 4-[[4-(ethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-1,3,5-triazin-2-yl]amino]naphthalene-2,7-disulfonic acid |
| SMILES | CCNc1nc(NCCOCCO)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)n1 |
| InChI | InChI=1S/C19H24N6O8S2/c1-2-20-17-23-18(21-5-7-33-8-6-26)25-19(24-17)22-16-11-14(35(30,31)32)10-12-9-13(34(27,28)29)3-4-15(12)16/h3-4,9-11,26H,2,5-8H2,1H3,(H,27,28,29)(H,30,31,32)(H3,20,21,22,23,24,25) |
| InChIKey | CQIFYRRJIVZNGV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 212.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|