C11H11NO8S3 — CID 58792546
4-(methanesulfonamido)naphthalene-2,7-disulfonic acid (PubChem CID 58792546) has the molecular formula C11H11NO8S3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 4-(methanesulfonamido)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-(methanesulfonamido)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 58792546 |
| Molecular Formula | C11H11NO8S3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 4-(methanesulfonamido)naphthalene-2,7-disulfonic acid |
| SMILES | CS(=O)(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C11H11NO8S3/c1-21(13,14)12-11-6-9(23(18,19)20)5-7-4-8(22(15,16)17)2-3-10(7)11/h2-6,12H,1H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | MESOXAPAWNMLJH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|