C16H21NO4S — CID 163232972
ethane;5-(2-methylpropanoylamino)naphthalene-2-sulfonic acid (PubChem CID 163232972) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is ethane;5-(2-methylpropanoylamino)naphthalene-2-sulfonic acid.
| Compound Name | ethane;5-(2-methylpropanoylamino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 163232972 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethane;5-(2-methylpropanoylamino)naphthalene-2-sulfonic acid |
| SMILES | CC.CC(C)C(=O)Nc1cccc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C14H15NO4S.C2H6/c1-9(2)14(16)15-13-5-3-4-10-8-11(20(17,18)19)6-7-12(10)13;1-2/h3-9H,1-2H3,(H,15,16)(H,17,18,19);1-2H3 |
| InChIKey | XFCOBAYMCBDDGR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|