C17H15NO7S — CID 168511862
5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]naphthalene-2-sulfonic acid (PubChem CID 168511862) has the molecular formula C17H15NO7S and a molecular weight of 377.37 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]naphthalene-2-sulfonic acid.
| Compound Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 168511862 |
| Molecular Formula | C17H15NO7S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]naphthalene-2-sulfonic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2cccc3cc(S(=O)(=O)O)ccc23)C(=O)O1 |
| InChI | InChI=1S/C17H15NO7S/c1-17(2)24-15(19)13(16(20)25-17)9-18-14-5-3-4-10-8-11(26(21,22)23)6-7-12(10)14/h3-9,18H,1-2H3,(H,21,22,23) |
| InChIKey | VANDOIMLKDMYFG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|