C14H16N2O7S — CID 168540873
3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-N-methylbenzenesulfonamide (PubChem CID 168540873) has the molecular formula C14H16N2O7S and a molecular weight of 356.36 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-N-methylbenzenesulfonamide.
| Compound Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 168540873 |
| Molecular Formula | C14H16N2O7S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(O)c(NC=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C14H16N2O7S/c1-14(2)22-12(18)9(13(19)23-14)7-16-10-6-8(4-5-11(10)17)24(20,21)15-3/h4-7,15-17H,1-3H3 |
| InChIKey | HCUTUBKQWFCLON-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|