C21H29ClN2O6S — CID 168539657
N,N-dibutyl-4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonamide (PubChem CID 168539657) has the molecular formula C21H29ClN2O6S and a molecular weight of 472.99 g/mol. Its IUPAC name is N,N-dibutyl-4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 168539657 |
| Molecular Formula | C21H29ClN2O6S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N,N-dibutyl-4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(Cl)c(NC=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C21H29ClN2O6S/c1-5-7-11-24(12-8-6-2)31(27,28)15-9-10-17(22)18(13-15)23-14-16-19(25)29-21(3,4)30-20(16)26/h9-10,13-14,23H,5-8,11-12H2,1-4H3 |
| InChIKey | YAHNDDBFEKPBGH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|