C12H17Cl2NO3S — CID 61448011
N-butyl-3,5-dichloro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 61448011) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is N-butyl-3,5-dichloro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-butyl-3,5-dichloro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61448011 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-butyl-3,5-dichloro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCCCN(CCO)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO3S/c1-2-3-4-15(5-6-16)19(17,18)12-8-10(13)7-11(14)9-12/h7-9,16H,2-6H2,1H3 |
| InChIKey | TZIOLBRHXIJTOT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |