C18H30ClNO2S — CID 3310777
4-chloro-N,N-dihexylbenzenesulfonamide (PubChem CID 3310777) has the molecular formula C18H30ClNO2S and a molecular weight of 359.96 g/mol. Its IUPAC name is 4-chloro-N,N-dihexylbenzenesulfonamide.
| Compound Name | 4-chloro-N,N-dihexylbenzenesulfonamide |
|---|---|
| PubChem CID | 3310777 |
| Molecular Formula | C18H30ClNO2S |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-chloro-N,N-dihexylbenzenesulfonamide |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H30ClNO2S/c1-3-5-7-9-15-20(16-10-8-6-4-2)23(21,22)18-13-11-17(19)12-14-18/h11-14H,3-10,15-16H2,1-2H3 |
| InChIKey | KKDLMPJKLYCYLH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|