C17H22ClN3O4S — CID 3702192
2-[(4-chlorophenyl)sulfonyl-hexylamino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 3702192) has the molecular formula C17H22ClN3O4S and a molecular weight of 399.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-hexylamino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-hexylamino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 3702192 |
| Molecular Formula | C17H22ClN3O4S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-hexylamino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3O4S/c1-2-3-4-5-11-21(13-17(22)19-16-10-12-25-20-16)26(23,24)15-8-6-14(18)7-9-15/h6-10,12H,2-5,11,13H2,1H3,(H,19,20,22) |
| InChIKey | LJFOHGYHFYGRPY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|