C14H24N4O3 — CID 3628865
2-[ethylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 3628865) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[ethylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[ethylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 3628865 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[ethylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)C(=O)NCC |
| InChI | InChI=1S/C14H24N4O3/c1-3-5-6-7-9-18(14(20)15-4-2)11-13(19)16-12-8-10-21-17-12/h8,10H,3-7,9,11H2,1-2H3,(H,15,20)(H,16,17,19) |
| InChIKey | ONMYFKCXXYFJCP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|