C15H19N3O3S — CID 4248802
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylthiophene-2-carboxamide (PubChem CID 4248802) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylthiophene-2-carboxamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4248802 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylthiophene-2-carboxamide |
| SMILES | CCCCCN(CC(=O)Nc1ccon1)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-3-4-8-18(15(20)12-6-5-10-22-12)11-14(19)16-13-7-9-21-17-13/h5-7,9-10H,2-4,8,11H2,1H3,(H,16,17,19) |
| InChIKey | RAVJYIBUQYMUSC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|