C19H25N3O5 — CID 42770937
2,6-dimethoxy-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylbenzamide (PubChem CID 42770937) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylbenzamide.
| Compound Name | 2,6-dimethoxy-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 42770937 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2,6-dimethoxy-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)Nc1ccon1)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H25N3O5/c1-4-5-6-11-22(13-17(23)20-16-10-12-27-21-16)19(24)18-14(25-2)8-7-9-15(18)26-3/h7-10,12H,4-6,11,13H2,1-3H3,(H,20,21,23) |
| InChIKey | XNAXMMPFUFJCBX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|