C15H23N3O3 — CID 5064786
N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 5064786) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 5064786 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)C(=O)C1CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-2-3-4-5-9-18(15(20)12-6-7-12)11-14(19)16-13-8-10-21-17-13/h8,10,12H,2-7,9,11H2,1H3,(H,16,17,19) |
| InChIKey | MESABEKYNAQUSL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|