C16H27N3O4 — CID 42771642
N-(3-methoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]heptanamide (PubChem CID 42771642) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]heptanamide.
| Compound Name | N-(3-methoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 42771642 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-(3-methoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCCOC)CC(=O)Nc1ccon1 |
| InChI | InChI=1S/C16H27N3O4/c1-3-4-5-6-8-16(21)19(10-7-11-22-2)13-15(20)17-14-9-12-23-18-14/h9,12H,3-8,10-11,13H2,1-2H3,(H,17,18,20) |
| InChIKey | MXLUYMIWFMBPKC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|