C15H23N3O6 — CID 4017704
methyl 5-[3-methoxypropyl-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]amino]-5-oxopentanoate (PubChem CID 4017704) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 5-[3-methoxypropyl-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]amino]-5-oxopentanoate.
| Compound Name | methyl 5-[3-methoxypropyl-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4017704 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl 5-[3-methoxypropyl-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]amino]-5-oxopentanoate |
| SMILES | COCCCN(CC(=O)Nc1ccon1)C(=O)CCCC(=O)OC |
| InChI | InChI=1S/C15H23N3O6/c1-22-9-4-8-18(14(20)5-3-6-15(21)23-2)11-13(19)16-12-7-10-24-17-12/h7,10H,3-6,8-9,11H2,1-2H3,(H,16,17,19) |
| InChIKey | PNTNHZQPLSEKNV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|