C15H19N3O4S — CID 3568028
N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 3568028) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3568028 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCOCCCN(CC(=O)Nc1ccon1)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H19N3O4S/c1-2-21-8-4-7-18(15(20)12-5-3-10-23-12)11-14(19)16-13-6-9-22-17-13/h3,5-6,9-10H,2,4,7-8,11H2,1H3,(H,16,17,19) |
| InChIKey | WVZPGNOWNCLIKV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|