C23H33N3O4 — CID 3649649
N-(3-ethoxypropyl)-4-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide (PubChem CID 3649649) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide.
| Compound Name | N-(3-ethoxypropyl)-4-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3649649 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-(3-ethoxypropyl)-4-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCCOCC)CC(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C23H33N3O4/c1-3-5-6-7-9-19-10-12-20(13-11-19)23(28)26(15-8-16-29-4-2)18-22(27)24-21-14-17-30-25-21/h10-14,17H,3-9,15-16,18H2,1-2H3,(H,24,25,27) |
| InChIKey | OMRPDQBQCKDZPF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|