C23H33N3O3 — CID 4087378
4-hexyl-N-(3-methylbutyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide (PubChem CID 4087378) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-hexyl-N-(3-methylbutyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-hexyl-N-(3-methylbutyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4087378 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 4-hexyl-N-(3-methylbutyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCC(C)C)CC(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-4-5-6-7-8-19-9-11-20(12-10-19)23(28)26(15-13-18(2)3)17-22(27)24-21-14-16-29-25-21/h9-12,14,16,18H,4-8,13,15,17H2,1-3H3,(H,24,25,27) |
| InChIKey | IFGSNPBTWHVYCG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|