C22H31N3O3 — CID 3705087
4-butyl-N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide (PubChem CID 3705087) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-butyl-N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-butyl-N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3705087 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 4-butyl-N-hexyl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)C(=O)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-3-5-7-8-15-25(17-21(26)23-20-14-16-28-24-20)22(27)19-12-10-18(11-13-19)9-6-4-2/h10-14,16H,3-9,15,17H2,1-2H3,(H,23,24,26) |
| InChIKey | ZSYTVMURMPTDNI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|