C19H26N4O3 — CID 42769290
2-[benzylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42769290) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[benzylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[benzylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42769290 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[benzylcarbamoyl(hexyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H26N4O3/c1-2-3-4-8-12-23(15-18(24)21-17-11-13-26-22-17)19(25)20-14-16-9-6-5-7-10-16/h5-7,9-11,13H,2-4,8,12,14-15H2,1H3,(H,20,25)(H,21,22,24) |
| InChIKey | CRONAPZCHMUKIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|